ChemNet > CAS > 1906-82-7 Ethyl acetamidoacetate
1906-82-7 Ethyl acetamidoacetate
| product Name |
Ethyl acetamidoacetate |
| CAS No |
1906-82-7 |
| Synonyms |
ethyl N-acetylglycinate; Ethyl Acetamideacetate; ethyl 2-(acetylamino)acetate; Ac-Gly-OEt |
| Molecular Formula |
C6H11NO3 |
| Molecular Weight |
145.1564 |
| InChI |
InChI=1/C6H11NO3/c1-3-10-6(9)4-7-5(2)8/h3-4H2,1-2H3,(H,7,8) |
| EINECS |
217-608-9 |
| Molecular Structure |
|
| Density |
1.059g/cm3 |
| Melting point |
43-46℃ |
| Boiling point |
262.8°C at 760 mmHg |
| Refractive index |
1.428 |
| Flash point |
110.9°C |
| Vapour Pressur |
0.0107mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
