ChemNet > CAS > 190661-29-1 (2-Benzyloxyphenyl)boronic acid
190661-29-1 (2-Benzyloxyphenyl)boronic acid
| product Name |
(2-Benzyloxyphenyl)boronic acid |
| CAS No |
190661-29-1 |
| Synonyms |
2-Benzyloxyphenylboronic acid; 2-Benzyloxybenzeneboronic acid; 2-Phenylmethoxy Phenylboronic Acid |
| Molecular Formula |
C13H13BO3 |
| Molecular Weight |
228.0515 |
| InChI |
InChI=1/C13H13BO3/c15-14(16)12-8-4-5-9-13(12)17-10-11-6-2-1-3-7-11/h1-9,15-16H,10H2 |
| Molecular Structure |
|
| Density |
1.2g/cm3 |
| Melting point |
105-110℃ |
| Boiling point |
428.7°C at 760 mmHg |
| Refractive index |
1.593 |
| Flash point |
213°C |
| Vapour Pressur |
4.13E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
