ChemNet > CAS > 19099-54-8 Iodocumene
19099-54-8 Iodocumene
| product Name |
Iodocumene |
| CAS No |
19099-54-8 |
| Synonyms |
2-Iodocumene~2-Isopropyliodobenzene; 1-Iodo-2-isopropylbenzene; 1-iodo-2-(propan-2-yl)benzene |
| Molecular Formula |
C9H11I |
| Molecular Weight |
246.0881 |
| InChI |
InChI=1/C9H11I/c1-7(2)8-5-3-4-6-9(8)10/h3-7H,1-2H3 |
| EINECS |
242-819-8 |
| Molecular Structure |
|
| Density |
1.523g/cm3 |
| Boiling point |
230.7°C at 760 mmHg |
| Refractive index |
1.574 |
| Flash point |
99.8°C |
| Vapour Pressur |
0.0981mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
