ChemNet > CAS > 1921-70-6 2,6,10,14-Tetramethylpentadecane
1921-70-6 2,6,10,14-Tetramethylpentadecane
| product Name |
2,6,10,14-Tetramethylpentadecane |
| CAS No |
1921-70-6 |
| Molecular Formula |
C19H40 |
| Molecular Weight |
268.5209 |
| InChI |
InChI=1/C19H40/c1-16(2)10-7-12-18(5)14-9-15-19(6)13-8-11-17(3)4/h16-19H,7-15H2,1-6H3 |
| EINECS |
217-650-8 |
| Molecular Structure |
|
| Density |
0.781g/cm3 |
| Boiling point |
296°C at 760 mmHg |
| Refractive index |
1.436 |
| Flash point |
140.7°C |
| Vapour Pressur |
0.0026mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
