ChemNet > CAS > 19212-42-1 1-(5-methyl-3-phenylisoxazol-4-yl)ethan-1-one
19212-42-1 1-(5-methyl-3-phenylisoxazol-4-yl)ethan-1-one
| product Name |
1-(5-methyl-3-phenylisoxazol-4-yl)ethan-1-one |
| CAS No |
19212-42-1 |
| Synonyms |
1-(5-methyl-3-phenyl-1,2-oxazol-4-yl)ethanone |
| Molecular Formula |
C12H11NO2 |
| Molecular Weight |
201.2212 |
| InChI |
InChI=1/C12H11NO2/c1-8(14)11-9(2)15-13-12(11)10-6-4-3-5-7-10/h3-7H,1-2H3 |
| Molecular Structure |
|
| Density |
1.127g/cm3 |
| Melting point |
56℃ |
| Boiling point |
359°C at 760 mmHg |
| Refractive index |
1.54 |
| Flash point |
170.9°C |
| Vapour Pressur |
2.46E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
