ChemNet > CAS > 19234-20-9 (2-Isopropoxyethyl) acetate
19234-20-9 (2-Isopropoxyethyl) acetate
| product Name |
(2-Isopropoxyethyl) acetate |
| CAS No |
19234-20-9 |
| Synonyms |
Isopropylglycol acetate; Ethyleneglycol monoisopropyl ether acetate; 2-(propan-2-yloxy)ethyl acetate |
| Molecular Formula |
C7H14O3 |
| Molecular Weight |
146.1843 |
| InChI |
InChI=1/C7H14O3/c1-6(2)9-4-5-10-7(3)8/h6H,4-5H2,1-3H3 |
| EINECS |
242-901-3 |
| Molecular Structure |
|
| Density |
0.947g/cm3 |
| Boiling point |
177.6°C at 760 mmHg |
| Refractive index |
1.406 |
| Flash point |
56.8°C |
| Vapour Pressur |
1.03mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
