ChemNet > CAS > 19241-36-2 5-Chloro-2-methylphenyl isothiocyanate
19241-36-2 5-Chloro-2-methylphenyl isothiocyanate
| product Name |
5-Chloro-2-methylphenyl isothiocyanate |
| CAS No |
19241-36-2 |
| Synonyms |
3-Chloro-6-methylisothiocyanatobenzene; 4-chloro-2-isothiocyanato-1-methylbenzene |
| Molecular Formula |
C8H6ClNS |
| Molecular Weight |
183.6579 |
| InChI |
InChI=1/C8H6ClNS/c1-6-2-3-7(9)4-8(6)10-5-11/h2-4H,1H3 |
| Molecular Structure |
|
| Density |
1.18g/cm3 |
| Boiling point |
293°C at 760 mmHg |
| Refractive index |
1.583 |
| Flash point |
131°C |
| Vapour Pressur |
0.0031mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
