ChemNet > CAS > 19250-09-0 1-(3,4-Dichlorophenyl)-2-thiourea
19250-09-0 1-(3,4-Dichlorophenyl)-2-thiourea
| product Name |
1-(3,4-Dichlorophenyl)-2-thiourea |
| CAS No |
19250-09-0 |
| Synonyms |
3,4-Dichlorophenylthiourea; 1-(3,4-dichlorophenyl)thiourea |
| Molecular Formula |
C7H6Cl2N2S |
| Molecular Weight |
221.1069 |
| InChI |
InChI=1/C7H6Cl2N2S/c8-5-2-1-4(3-6(5)9)11-7(10)12/h1-3H,(H3,10,11,12) |
| EINECS |
242-919-1 |
| Molecular Structure |
|
| Density |
1.563g/cm3 |
| Melting point |
210-213℃ |
| Boiling point |
327.7°C at 760 mmHg |
| Refractive index |
1.73 |
| Flash point |
152°C |
| Vapour Pressur |
0.000198mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
