ChemNet > CAS > 1930-72-9 4-Chloro-3,5-dinitrobenzonitrile
1930-72-9 4-Chloro-3,5-dinitrobenzonitrile
| product Name |
4-Chloro-3,5-dinitrobenzonitrile |
| CAS No |
1930-72-9 |
| Synonyms |
Benzonitrile, 4-chloro-3,5-dinitro-; 4-Chloro-3,5-dinitrobenzenenitrile; AI3-28718; BRN 1990451; NSC 74453 |
| Molecular Formula |
C7H2ClN3O4 |
| Molecular Weight |
227.5615 |
| InChI |
InChI=1/C7H2ClN3O4/c8-7-5(10(12)13)1-4(3-9)2-6(7)11(14)15/h1-2H |
| EINECS |
217-686-4 |
| Molecular Structure |
|
| Density |
1.68g/cm3 |
| Melting point |
137-143℃ |
| Boiling point |
326.3°C at 760 mmHg |
| Refractive index |
1.631 |
| Flash point |
151.2°C |
| Vapour Pressur |
0.000217mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
