ChemNet > CAS > 19317-11-4 farnesal, mixture of isomers
19317-11-4 farnesal, mixture of isomers
| product Name |
farnesal, mixture of isomers |
| CAS No |
19317-11-4 |
| Synonyms |
Farnesal; 3,7,11-trimethyldodeca-2,6,10-trienal; (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienal |
| Molecular Formula |
C15H24O |
| Molecular Weight |
220.3505 |
| InChI |
InChI=1/C15H24O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11-12H,5-6,8,10H2,1-4H3/b14-9+,15-11+ |
| EINECS |
242-957-9 |
| Molecular Structure |
|
| Density |
0.868g/cm3 |
| Boiling point |
328.6°C at 760 mmHg |
| Refractive index |
1.475 |
| Flash point |
147.8°C |
| Vapour Pressur |
0.000187mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
