ChemNet > CAS > 19398-47-1 1,4-Dibromo-2-butanol
19398-47-1 1,4-Dibromo-2-butanol
| product Name |
1,4-Dibromo-2-butanol |
| CAS No |
19398-47-1 |
| Synonyms |
1,4-Dibromo-2-butanol, Pract.; 1-Aminonaphthalene-4-sulfonic acid; 1,4-dibromobutan-2-ol; (2S)-1,4-dibromobutan-2-ol; (2R)-1,4-dibromobutan-2-ol |
| Molecular Formula |
C4H8Br2O |
| Molecular Weight |
231.9137 |
| InChI |
InChI=1/C4H8Br2O/c5-2-1-4(7)3-6/h4,7H,1-3H2/t4-/m1/s1 |
| EINECS |
243-029-6 |
| Molecular Structure |
|
| Density |
1.951g/cm3 |
| Boiling point |
220.1°C at 760 mmHg |
| Refractive index |
1.544 |
| Flash point |
116.5°C |
| Vapour Pressur |
0.024mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
