ChemNet > CAS > 19398-61-9 2,5-Dichlorotoluene
19398-61-9 2,5-Dichlorotoluene
| product Name |
2,5-Dichlorotoluene |
| CAS No |
19398-61-9 |
| Synonyms |
Benzene, 1,4-dichloro-2-methyl-; NSC 86117; Toluene, 2,5-dichloro- (8CI); 1,4-dichloro-2-methylbenzene |
| Molecular Formula |
C7H6Cl2 |
| Molecular Weight |
161.0285 |
| InChI |
InChI=1/C7H6Cl2/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
| EINECS |
243-032-2 |
| Molecular Structure |
|
| Density |
1.242g/cm3 |
| Melting point |
4-5℃ |
| Boiling point |
197.4°C at 760 mmHg |
| Refractive index |
1.543 |
| Flash point |
79.4°C |
| Vapour Pressur |
0.533mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
