ChemNet > CAS > 1942-52-5 2-Diethylaminoethanethiol hydrochloride
1942-52-5 2-Diethylaminoethanethiol hydrochloride
| product Name |
2-Diethylaminoethanethiol hydrochloride |
| CAS No |
1942-52-5 |
| Synonyms |
diethyl-2-mercaptoethylammonium chloride; 2-Diethylaminoethanthiol Hydrochloride; 2-(diethylamino)ethanethiol hydrochloride (1:1); N,N-diethyl-2-sulfanylethanaminium |
| Molecular Formula |
C6H16NS |
| Molecular Weight |
134.2624 |
| InChI |
InChI=1/C6H15NS/c1-3-7(4-2)5-6-8/h8H,3-6H2,1-2H3/p+1 |
| EINECS |
217-731-8 |
| Molecular Structure |
|
| Melting point |
168-175℃ |
| Boiling point |
161.6°C at 760 mmHg |
| Flash point |
51.5°C |
| Vapour Pressur |
2.26mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
