ChemNet > CAS > 19437-26-4 Di-2-pyridyl ketone
19437-26-4 Di-2-pyridyl ketone
| product Name |
Di-2-pyridyl ketone |
| Synonyms |
Dipyridylketone; Di(2-pyridyl)ketone; dipyridin-2-ylmethanone |
| Molecular Formula |
C11H8N2O |
| Molecular Weight |
184.194 |
| InChI |
InChI=1/C11H8N2O/c14-11(9-5-1-3-7-12-9)10-6-2-4-8-13-10/h1-8H |
| CAS Registry Number |
19437-26-4 |
| EINECS |
243-067-3 |
| Molecular Structure |
|
| Density |
1.196g/cm3 |
| Melting point |
52-55℃ |
| Boiling point |
343.5°C at 760 mmHg |
| Refractive index |
1.593 |
| Flash point |
165.7°C |
| Vapour Pressur |
7.01E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Di-2-pyridyl ketone Material Safety Data Sheet
|
|
