ChemNet > CAS > 1947-47-3 3-Amino-2-phenylindenone
1947-47-3 3-Amino-2-phenylindenone
| product Name |
3-Amino-2-phenylindenone |
| CAS No |
1947-47-3 |
| Synonyms |
3-Amino-2-phenyl-1H-inden-1-one; (2R,3Z)-3-imino-2-phenyl-2,3-dihydro-1H-inden-1-one |
| Molecular Formula |
C15H11NO |
| Molecular Weight |
221.2539 |
| InChI |
InChI=1/C15H11NO/c16-14-11-8-4-5-9-12(11)15(17)13(14)10-6-2-1-3-7-10/h1-9,13,16H/b16-14+/t13-/m1/s1 |
| Molecular Structure |
|
| Density |
1.21g/cm3 |
| Melting point |
270℃ |
| Boiling point |
415.6°C at 760 mmHg |
| Refractive index |
1.652 |
| Flash point |
205.1°C |
| Vapour Pressur |
4.09E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
