ChemNet > CAS > 195383-80-3 2-Bromo-4,5-dimethoxycinnamic acid
195383-80-3 2-Bromo-4,5-dimethoxycinnamic acid
| product Name |
2-Bromo-4,5-dimethoxycinnamic acid |
| CAS No |
195383-80-3 |
| Synonyms |
(2E)-3-(2-bromo-4,5-dimethoxyphenyl)prop-2-enoate |
| Molecular Formula |
C11H10BrO4 |
| Molecular Weight |
286.0992 |
| InChI |
InChI=1/C11H11BrO4/c1-15-9-5-7(3-4-11(13)14)8(12)6-10(9)16-2/h3-6H,1-2H3,(H,13,14)/p-1/b4-3+ |
| Molecular Structure |
|
| Melting point |
253-254℃ |
| Boiling point |
409.5°C at 760 mmHg |
| Flash point |
201.4°C |
| Vapour Pressur |
1.94E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
