ChemNet > CAS > 19542-77-9 N-Acetyl-S-benzyl-L-cysteine
19542-77-9 N-Acetyl-S-benzyl-L-cysteine
| product Name |
N-Acetyl-S-benzyl-L-cysteine |
| CAS No |
19542-77-9 |
| Synonyms |
S-Benzyl-N-acetyl-L-cysteine; Benzylmercapturic acid; S-Benzylmercapturic acid; SBNAC; L-Cysteine, N-acetyl-S-(phenylmethyl)-; methyl N-acetyl-S-phenyl-L-cysteinate; (2R)-2-(acetylamino)-3-(benzylsulfanyl)propanoate |
| Molecular Formula |
C12H14NO3S |
| Molecular Weight |
252.31 |
| InChI |
InChI=1/C12H15NO3S/c1-9(14)13-11(12(15)16)8-17-7-10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3,(H,13,14)(H,15,16)/p-1/t11-/m0/s1 |
| Molecular Structure |
|
| Melting point |
139-143℃ |
| Boiling point |
506.2°C at 760 mmHg |
| Flash point |
259.9°C |
| Vapour Pressur |
4.55E-11mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
