ChemNet > CAS > 1963-36-6 4-Methoxycinnamaldehyde
1963-36-6 4-Methoxycinnamaldehyde
| product Name |
4-Methoxycinnamaldehyde |
| CAS No |
1963-36-6 |
| Synonyms |
2-Propenal, 3-(4-methoxyphenyl)-; 3-(4-Methoxyphenyl)-2-propenal; AI3-05957; Cinnamaldehyde, p-methoxy-; FEMA No. 3567; NSC 26454; p-Methoxycinnamaldehyde; p-Methoxycinnamic aldehyde; Cinnamaldehyde, p-methoxy- (8CI); Methoxycinnamaldehyde, p-; 3-(4-methoxyphenyl)prop-2-enal; (2E)-3-(4-methoxyphenyl)prop-2-enal |
| Molecular Formula |
C10H10O2 |
| Molecular Weight |
162.1852 |
| InChI |
InChI=1/C10H10O2/c1-12-10-6-4-9(5-7-10)3-2-8-11/h2-8H,1H3/b3-2+ |
| EINECS |
217-807-0 |
| Molecular Structure |
|
| Density |
1.068g/cm3 |
| Boiling point |
308.7°C at 760 mmHg |
| Refractive index |
1.559 |
| Flash point |
146.5°C |
| Vapour Pressur |
0.00067mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
