ChemNet > CAS > 1967-25-5 4-Bromophenylurea
1967-25-5 4-Bromophenylurea
| product Name |
4-Bromophenylurea |
| CAS No |
1967-25-5 |
| Synonyms |
Urea, (4-bromophenyl)-; AI3-61301; 1-(4-bromophenyl)urea |
| Molecular Formula |
C7H7BrN2O |
| Molecular Weight |
215.0473 |
| InChI |
InChI=1/C7H7BrN2O/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| Molecular Structure |
|
| Density |
1.708g/cm3 |
| Boiling point |
290.9°C at 760 mmHg |
| Refractive index |
1.671 |
| Flash point |
129.7°C |
| Vapour Pressur |
0.00202mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
