ChemNet > CAS > 19788-49-9 Mercaptopropionicacidethylester
19788-49-9 Mercaptopropionicacidethylester
| product Name |
Mercaptopropionicacidethylester |
| CAS No |
19788-49-9 |
| Synonyms |
2-Mercaptopropionic acid ethyl ester; Ethyl thiolactate~2-Mercaptopropionic acid ethyl ester; ethyl 2-sulfanylpropanoate; Ethyl 2-mercaptopropionate |
| Molecular Formula |
C5H10O2S |
| Molecular Weight |
134.1967 |
| InChI |
InChI=1/C5H10O2S/c1-3-7-5(6)4(2)8/h4,8H,3H2,1-2H3 |
| EINECS |
243-314-5 |
| Molecular Structure |
|
| Density |
1.04g/cm3 |
| Boiling point |
171.7°C at 760 mmHg |
| Refractive index |
1.452 |
| Flash point |
57.4°C |
| Vapour Pressur |
1.38mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
