ChemNet > CAS > 19806-17-8 1,3-Phenylenediacetic acid
19806-17-8 1,3-Phenylenediacetic acid
| product Name |
1,3-Phenylenediacetic acid |
| CAS No |
19806-17-8 |
| Synonyms |
m-Phenylendiacetic acid; Benzene-1,3-diacetic acid; 1,3-Bis-(carboxymethyl)-benzene; 2,2'-benzene-1,2-diyldiacetic acid; 2,2'-benzene-1,3-diyldiacetic acid; 2,2'-benzene-1,3-diyldiacetate |
| Molecular Formula |
C10H8O4 |
| Molecular Weight |
192.1692 |
| InChI |
InChI=1/C10H10O4/c11-9(12)5-7-2-1-3-8(4-7)6-10(13)14/h1-4H,5-6H2,(H,11,12)(H,13,14)/p-2 |
| EINECS |
243-332-3 |
| Molecular Structure |
|
| Melting point |
173-177℃ |
| Boiling point |
408.6°C at 760 mmHg |
| Flash point |
215.1°C |
| Vapour Pressur |
2.08E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
