ChemNet > CAS > 19832-98-5 4-Methyl-1-tetralone
19832-98-5 4-Methyl-1-tetralone
| product Name |
4-Methyl-1-tetralone |
| CAS No |
19832-98-5 |
| Synonyms |
1,2,3,4-tetrahydro-4-methylnaphthalen-1-one; 4-methyl-3,4-dihydronaphthalen-1(2H)-one; (4R)-4-methyl-3,4-dihydronaphthalen-1(2H)-one; (4S)-4-methyl-3,4-dihydronaphthalen-1(2H)-one |
| Molecular Formula |
C11H12O |
| Molecular Weight |
160.2124 |
| InChI |
InChI=1/C11H12O/c1-8-6-7-11(12)10-5-3-2-4-9(8)10/h2-5,8H,6-7H2,1H3/t8-/m0/s1 |
| EINECS |
243-355-9 |
| Molecular Structure |
|
| Density |
1.048g/cm3 |
| Boiling point |
275.2°C at 760 mmHg |
| Refractive index |
1.539 |
| Flash point |
100.7°C |
| Vapour Pressur |
0.00515mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
