ChemNet > CAS > 1984-59-4 2,3-Dichloroanisole
1984-59-4 2,3-Dichloroanisole
| product Name |
2,3-Dichloroanisole |
| CAS No |
1984-59-4 |
| Synonyms |
1,2-Dichloro-3-methoxybenzene; ; 1,2-dichloro-3-methoxybenzene |
| Molecular Formula |
C7H6Cl2O |
| Molecular Weight |
177.0279 |
| InChI |
InChI=1/C7H6Cl2O/c1-10-6-4-2-3-5(8)7(6)9/h2-4H,1H3 |
| EINECS |
217-853-1 |
| Molecular Structure |
|
| Density |
1.289g/cm3 |
| Melting point |
30-35℃ |
| Boiling point |
223.4°C at 760 mmHg |
| Refractive index |
1.534 |
| Flash point |
94.7°C |
| Vapour Pressur |
0.144mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
