ChemNet > CAS > 19952-47-7 2-Amino-4-chlorobenzothiazole
19952-47-7 2-Amino-4-chlorobenzothiazole
| product Name |
2-Amino-4-chlorobenzothiazole |
| CAS No |
19952-47-7 |
| Synonyms |
4-chloro-1,3-benzothiazol-2-ylamine; 4-chlorobenzo[d]thiazol-2-amine; 4-chloro-1,3-benzothiazol-2-amine |
| Molecular Formula |
C7H5ClN2S |
| Molecular Weight |
184.646 |
| InChI |
InChI=1/C7H5ClN2S/c8-4-2-1-3-5-6(4)10-7(9)11-5/h1-3H,(H2,9,10) |
| EINECS |
243-439-5 |
| Molecular Structure |
|
| Density |
1.532g/cm3 |
| Melting point |
203-208℃ |
| Boiling point |
344.3°C at 760 mmHg |
| Refractive index |
1.762 |
| Flash point |
162°C |
| Vapour Pressur |
6.65E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
