ChemNet > CAS > 20007-72-1 9-Methyl-delta-5(10)-octaline-1,6-dione
20007-72-1 9-Methyl-delta-5(10)-octaline-1,6-dione
| product Name |
9-Methyl-delta-5(10)-octaline-1,6-dione |
| CAS No |
20007-72-1 |
| Synonyms |
Wieland-Miescher ketone; (+/-)-9-Methyl-DELTA(5,10)-octalin-1,6-dione; (+/-)-3,4,8,8a-Tetrahydro-8a-methyl-1,6(2H,7H)-naphthalenedione; 8a-methyl-3,4,8,8a-tetrahydronaphthalene-1,6(2H,7H)-dione; (8aS)-8a-methyl-3,4,8,8a-tetrahydronaphthalene-1,6(2H,7H)-dione |
| Molecular Formula |
C11H14O2 |
| Molecular Weight |
178.2277 |
| InChI |
InChI=1/C11H14O2/c1-11-6-5-9(12)7-8(11)3-2-4-10(11)13/h7H,2-6H2,1H3/t11-/m0/s1 |
| EINECS |
243-463-6 |
| Molecular Structure |
|
| Density |
1.1g/cm3 |
| Melting point |
47-50℃ |
| Boiling point |
325.5°C at 760 mmHg |
| Refractive index |
1.519 |
| Flash point |
122°C |
| Vapour Pressur |
0.000229mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
