ChemNet > CAS > 2001-93-6 Dithiouracil
2001-93-6 Dithiouracil
product Name |
Dithiouracil |
Synonyms |
2,4(1H,3H)-Pyrimidinedithione; 2,4-Dithiopyrimidine; pyrimidine-2,4-dithiol; pyrimidine-2,4(1H,3H)-dithione; 2,4-dimercaptopyrimidine |
Molecular Formula |
C4H4N2S2 |
Molecular Weight |
144.218 |
InChI |
InChI=1/C4H4N2S2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) |
CAS Registry Number |
2001-93-6 |
EINECS |
217-894-5 |
Molecular Structure |
|
Density |
1.5g/cm3 |
Melting point |
279-281℃ |
Boiling point |
225.6°C at 760 mmHg |
Refractive index |
1.776 |
Flash point |
90.3°C |
Vapour Pressur |
0.0855mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|