ChemNet > CAS > 20017-68-9 1-Bromo-3,3-diphenylpropane
20017-68-9 1-Bromo-3,3-diphenylpropane
| product Name |
1-Bromo-3,3-diphenylpropane |
| CAS No |
20017-68-9 |
| Synonyms |
3,3-Diphenylpropyl bromide; 1,1'-(3-bromopropane-1,1-diyl)dibenzene |
| Molecular Formula |
C15H15Br |
| Molecular Weight |
275.1836 |
| InChI |
InChI=1/C15H15Br/c16-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11-12H2 |
| EINECS |
243-467-8 |
| Molecular Structure |
|
| Density |
1.275g/cm3 |
| Melting point |
39-42℃ |
| Boiling point |
317.4°C at 760 mmHg |
| Refractive index |
1.587 |
| Flash point |
143.2°C |
| Vapour Pressur |
0.000719mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
| MSDS |
Material Safety Data Sheet
|
|
