ChemNet > CAS > 20028-53-9 2-Amino-5-chlorobenzaldehyde
20028-53-9 2-Amino-5-chlorobenzaldehyde
| product Name |
2-Amino-5-chlorobenzaldehyde |
| CAS No |
20028-53-9 |
| Synonyms |
6-Amino-3-chlorobenzaldehyde |
| Molecular Formula |
C7H6ClNO |
| Molecular Weight |
155.5816 |
| InChI |
InChI=1/C7H6ClNO/c8-6-1-2-7(9)5(3-6)4-10/h1-4H,9H2 |
| Molecular Structure |
|
| Density |
1.348g/cm3 |
| Boiling point |
288.1°C at 760 mmHg |
| Refractive index |
1.651 |
| Flash point |
128°C |
| Vapour Pressur |
0.00239mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
