| product Name |
triethylammonium (2,4,5-trichlorophenoxy)acetate |
| CAS No |
2008-46-0 |
| Synonyms |
2,4,5-T-triethylammonium [ISO]; 2,4,5-T triethylamine salt; 2,4,5-T-triethylammonium; 2,4,5-Trichlorophenoxyacetic acid triethylamine salt; Caswell No. 881K; EPA Pesticide Chemical Code 082034; Acetic acid, (2,4,5-trichlorophenoxy)-, compd. with N,N-diethylethanamine (1:1); 2,4,5-T Triethylamine; Acetic acid, (2,4,5-trichlorophenoxy)-, compd. with N,N-diethylethanamine; (2,4,5-trichlorophenoxy)acetic acid - N,N-diethylethanamine (1:1) |
| Molecular Formula |
C14H20Cl3NO3 |
| Molecular Weight |
356.6725 |
| InChI |
InChI=1/C8H5Cl3O3.C6H15N/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13;1-4-7(5-2)6-3/h1-2H,3H2,(H,12,13);4-6H2,1-3H3 |
| EINECS |
217-917-9 |
| Molecular Structure |
|
| Boiling point |
376.3°C at 760 mmHg |
| Flash point |
181.4°C |
| Vapour Pressur |
2.48E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
