ChemNet > CAS > 20120-21-2 ethyl 3-dimethylaminopropionate
20120-21-2 ethyl 3-dimethylaminopropionate
| product Name |
ethyl 3-dimethylaminopropionate |
| CAS No |
20120-21-2 |
| Synonyms |
beta-Alanine, N,N-dimethyl-, ethyl ester; 4-04-00-02530 (Beilstein Handbook Reference); BRN 1702477; Ethyl 3-(dimethylamino)propionate; Ethyl beta-(dimethylamino)propionate; N,N-Dimethyl-beta-alanine ethyl ester; Ethyl N,N-dimethyl-beta-alaninate; ethyl N,N-diethyl-beta-alaninate |
| Molecular Formula |
C9H19NO2 |
| Molecular Weight |
173.2527 |
| InChI |
InChI=1/C9H19NO2/c1-4-10(5-2)8-7-9(11)12-6-3/h4-8H2,1-3H3 |
| EINECS |
243-524-7 |
| Molecular Structure |
|
| Density |
0.922g/cm3 |
| Boiling point |
215.5°C at 760 mmHg |
| Refractive index |
1.437 |
| Flash point |
71.7°C |
| Vapour Pressur |
0.148mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
