ChemNet > CAS > 20261-31-8 4-Hydroxy-3-nitrocoumarin
20261-31-8 4-Hydroxy-3-nitrocoumarin
| product Name |
4-Hydroxy-3-nitrocoumarin |
| CAS No |
20261-31-8 |
| Synonyms |
3-NITRO-4-HYDROXYCOUMARIN; 2-hydroxy-3-nitro-4H-chromen-4-one; 4-hydroxy-3-nitro-2H-chromen-2-one |
| Molecular Formula |
C9H5NO5 |
| Molecular Weight |
207.1397 |
| InChI |
InChI=1/C9H5NO5/c11-8-5-3-1-2-4-6(5)15-9(12)7(8)10(13)14/h1-4,11H |
| Molecular Structure |
|
| Density |
1.638g/cm3 |
| Melting point |
171-173℃ |
| Boiling point |
364.492°C at 760 mmHg |
| Refractive index |
1.674 |
| Flash point |
174.239°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
