ChemNet > CAS > 20280-81-3 4-Methoxycoumarin
20280-81-3 4-Methoxycoumarin
| product Name |
4-Methoxycoumarin |
| CAS No |
20280-81-3 |
| Synonyms |
4-Methoxycourmarin; 2H-1-Benzopyran-2-one, 4-methoxy-; 4-methoxy-2H-chromen-2-one |
| Molecular Formula |
C10H8O3 |
| Molecular Weight |
176.1687 |
| InChI |
InChI=1/C10H8O3/c1-12-9-6-10(11)13-8-5-3-2-4-7(8)9/h2-6H,1H3 |
| Molecular Structure |
|
| Density |
1.26g/cm3 |
| Boiling point |
347.8°C at 760 mmHg |
| Refractive index |
1.581 |
| Flash point |
144.5°C |
| Vapour Pressur |
5.27E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
