ChemNet > CAS > 202865-85-8 2-Bromo-5-iodotoluene
202865-85-8 2-Bromo-5-iodotoluene
| product Name |
2-Bromo-5-iodotoluene |
| CAS No |
202865-85-8 |
| Synonyms |
1-bromo-4-iodo-2-methylbenzene |
| Molecular Formula |
C7H6BrI |
| Molecular Weight |
296.931 |
| InChI |
InChI=1/C7H6BrI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
| Molecular Structure |
|
| Density |
2.062g/cm3 |
| Boiling point |
264.2°C at 760 mmHg |
| Refractive index |
1.636 |
| Flash point |
113.6°C |
| Vapour Pressur |
0.0161mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
