ChemNet > CAS > 202925-04-0 2-Chloro-1,5-dibromo-3-fluorobenzene
202925-04-0 2-Chloro-1,5-dibromo-3-fluorobenzene
| product Name |
2-Chloro-1,5-dibromo-3-fluorobenzene |
| CAS No |
202925-04-0 |
| Synonyms |
2-Chloro-3,5-dibromo-1-fluorobenzene; 1,5-Dibromo-2-chloro-3-fluorobenzene; 1,5-Dibromo-2-chloro-3-fluorobenzene |
| Molecular Formula |
C6H2Br2ClF |
| Molecular Weight |
288.34 |
| InChI |
InChI:1S/C6H2Br2ClF/c7-3-1-4(8)6(9)5(10)2-3/h1-2H |
| Molecular Structure |
|
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
