ChemNet > CAS > 202925-07-3 3-Chloro-4-fluoroanisole
202925-07-3 3-Chloro-4-fluoroanisole
| product Name |
3-Chloro-4-fluoroanisole |
| CAS No |
202925-07-3 |
| Synonyms |
2-chloro-1-fluoro-4-methoxybenzene |
| Molecular Formula |
C7H6ClFO |
| Molecular Weight |
160.5733 |
| InChI |
InChI=1/C7H6ClFO/c1-10-5-2-3-7(9)6(8)4-5/h2-4H,1H3 |
| Molecular Structure |
|
| Density |
1.239g/cm3 |
| Boiling point |
202.8°C at 760 mmHg |
| Refractive index |
1.495 |
| Flash point |
76.4°C |
| Vapour Pressur |
0.409mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
