ChemNet > CAS > 20300-02-1 Thiophene-2-thiocarboxamide
20300-02-1 Thiophene-2-thiocarboxamide
| product Name |
Thiophene-2-thiocarboxamide |
| CAS No |
20300-02-1 |
| Synonyms |
Thiophene-2-carbothioamide |
| Molecular Formula |
C5H5NS2 |
| Molecular Weight |
143.2299 |
| InChI |
InChI=1/C5H5NS2/c6-5(7)4-2-1-3-8-4/h1-3H,(H2,6,7) |
| Molecular Structure |
|
| Density |
1.357g/cm3 |
| Melting point |
106℃ |
| Boiling point |
259.5°C at 760 mmHg |
| Refractive index |
1.701 |
| Flash point |
110.7°C |
| Vapour Pressur |
0.0129mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R25:Toxic if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
