ChemNet > CAS > 20323-74-4 Ethyl 2-amino-4,5-dimethoxybenzoate
20323-74-4 Ethyl 2-amino-4,5-dimethoxybenzoate
| product Name |
Ethyl 2-amino-4,5-dimethoxybenzoate |
| CAS No |
20323-74-4 |
| Synonyms |
2-Amino-4,5-dimethoxybenzoic acid ethyl ester |
| Molecular Formula |
C11H15NO4 |
| Molecular Weight |
225.2411 |
| InChI |
InChI=1/C11H15NO4/c1-4-16-11(13)7-5-9(14-2)10(15-3)6-8(7)12/h5-6H,4,12H2,1-3H3 |
| EINECS |
243-732-8 |
| Molecular Structure |
|
| Density |
1.16g/cm3 |
| Boiling point |
355.9°C at 760 mmHg |
| Refractive index |
1.533 |
| Flash point |
164°C |
| Vapour Pressur |
3.02E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
