2039-76-1 3-acetylphenanthrene
product Name |
3-acetylphenanthrene |
CAS No |
2039-76-1 |
Synonyms |
methyl 3-phenanthryl ketone; 1-(phenanthren-3-yl)ethanone |
Molecular Formula |
C16H12O |
Molecular Weight |
220.2659 |
InChI |
InChI=1/C16H12O/c1-11(17)14-9-8-13-7-6-12-4-2-3-5-15(12)16(13)10-14/h2-10H,1H3 |
EINECS |
218-020-5 |
Molecular Structure |
|
Density |
1.164g/cm3 |
Melting point |
67-71℃ |
Boiling point |
405.9°C at 760 mmHg |
Refractive index |
1.685 |
Flash point |
180.7°C |
Vapour Pressur |
8.47E-07mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|