ChemNet > CAS > 2039-89-6 2,5-Dimethylstyrene
2039-89-6 2,5-Dimethylstyrene
| product Name |
2,5-Dimethylstyrene |
| CAS No |
2039-89-6 |
| Synonyms |
Styrene, 2,5-dimethyl-; 1,4-Dimethyl-2-ethenylbenzene; 1,4-Dimethyl-2-vinylbenzene; 4-05-00-01385 (Beilstein Handbook Reference); BRN 2203656; NSC 73477; Benzene, 2-ethenyl-1,4-dimethyl- (9CI); 2-ethenyl-1,4-dimethylbenzene |
| Molecular Formula |
C10H12 |
| Molecular Weight |
132.2023 |
| InChI |
InChI=1/C10H12/c1-4-10-7-8(2)5-6-9(10)3/h4-7H,1H2,2-3H3 |
| EINECS |
218-028-9 |
| Molecular Structure |
|
| Density |
0.893g/cm3 |
| Boiling point |
194.1°C at 760 mmHg |
| Refractive index |
1.545 |
| Flash point |
58.8°C |
| Vapour Pressur |
0.628mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37:Irritating to eyes and respiratory system.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
