ChemNet > CAS > 2040-01-9 2',3',4',5',6'-Pentamethylacetophenone
2040-01-9 2',3',4',5',6'-Pentamethylacetophenone
| product Name |
2',3',4',5',6'-Pentamethylacetophenone |
| CAS No |
2040-01-9 |
| Synonyms |
2,3,4,5,6-Pentamethylacetophenone; 1-(pentamethylphenyl)ethanone |
| Molecular Formula |
C13H18O |
| Molecular Weight |
190.2814 |
| InChI |
InChI=1/C13H18O/c1-7-8(2)10(4)13(12(6)14)11(5)9(7)3/h1-6H3 |
| EINECS |
218-033-6 |
| Molecular Structure |
|
| Density |
0.94g/cm3 |
| Melting point |
82-84℃ |
| Boiling point |
311.4°C at 760 mmHg |
| Refractive index |
1.508 |
| Flash point |
131°C |
| Vapour Pressur |
0.000564mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
