ChemNet > CAS > 20485-41-0 4-methylthiazole-5-carboxylic acid
20485-41-0 4-methylthiazole-5-carboxylic acid
| product Name |
4-methylthiazole-5-carboxylic acid |
| CAS No |
20485-41-0 |
| Synonyms |
4-Methyl-thiazole-5-carboxylic acid; 4-Methylthiazole-5-Carboxylate; 4-methyl-1,3-thiazole-5-carboxylic acid; 4-Methyl-5-thiazolecarboxylic acid |
| Molecular Formula |
C10H9NO |
| Molecular Weight |
159.1846 |
| InChI |
InChI=1/C10H9NO/c1-12-10-3-2-9-7-11-5-4-8(9)6-10/h2-7H,1H3 |
| Molecular Structure |
|
| Density |
1.131g/cm3 |
| Melting point |
250℃ |
| Boiling point |
295.593°C at 760 mmHg |
| Refractive index |
1.611 |
| Flash point |
108.428°C |
| Vapour Pressur |
0.003mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
