2050-23-9 Diethyl suberate
product Name |
Diethyl suberate |
CAS No |
2050-23-9 |
Synonyms |
Diethyl suberate, (Diethyl octanedioate; Suberic acid d; 2050-23-9Diethyl suberate; Diethyl octanedioate~Suberic acid diethyl ester; Octanedioic acid diethyl ester~Suberic acid diethyl ester; diethyl octanedioate |
Molecular Formula |
C12H22O4 |
Molecular Weight |
230.3007 |
InChI |
InChI=1/C12H22O4/c1-3-15-11(13)9-7-5-6-8-10-12(14)16-4-2/h3-10H2,1-2H3 |
EINECS |
218-084-4 |
Molecular Structure |
|
Density |
0.985g/cm3 |
Melting point |
5-284℃ |
Boiling point |
282.6°C at 760 mmHg |
Refractive index |
1.436 |
Flash point |
123.3°C |
Vapour Pressur |
0.00332mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
MSDS |
Material Safety Data Sheet
|
|