ChemNet > CAS > 2051-18-5 4-Isopropylbenzyl chloride
2051-18-5 4-Isopropylbenzyl chloride
| product Name |
4-Isopropylbenzyl chloride |
| CAS No |
2051-18-5 |
| Synonyms |
Benzene, 1-(chloromethyl)-4-(1-methylethyl)-; Benzene, 1-(chloromethyl)-4-(methylethyl)-; NSC 33915; p-Cymene, 7-chloro-; p-Isopropyl benzyl chloride; p-Isopropylbenzyl chloride; 7-Chloro-p-cymene; 1-(chloromethyl)-4-(propan-2-yl)benzene |
| Molecular Formula |
C10H13Cl |
| Molecular Weight |
168.6632 |
| InChI |
InChI=1/C10H13Cl/c1-8(2)10-5-3-9(7-11)4-6-10/h3-6,8H,7H2,1-2H3 |
| EINECS |
218-114-6 |
| Molecular Structure |
|
| Density |
1.008g/cm3 |
| Boiling point |
228.2°C at 760 mmHg |
| Refractive index |
1.512 |
| Flash point |
88.6°C |
| Vapour Pressur |
0.112mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
