ChemNet > CAS > 2051-49-2 Hexanoic anhydride
2051-49-2 Hexanoic anhydride
| product Name |
Hexanoic anhydride |
| CAS No |
2051-49-2 |
| Synonyms |
Caproic anhydride; Hexanoic Acid Anhydride; N-hexanoic anhydride |
| Molecular Formula |
C12H22O3 |
| Molecular Weight |
214.3013 |
| InChI |
InChI=1/C12H22O3/c1-3-5-7-9-11(13)15-12(14)10-8-6-4-2/h3-10H2,1-2H3 |
| EINECS |
218-121-4 |
| Molecular Structure |
|
| Density |
0.943g/cm3 |
| Melting point |
-40℃ |
| Boiling point |
247°C at 760 mmHg |
| Refractive index |
1.436 |
| Flash point |
116.6°C |
| Vapour Pressur |
0.0263mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
