ChemNet > CAS > 2052-06-4 4-Bromo-N,N-diethylaniline
2052-06-4 4-Bromo-N,N-diethylaniline
| product Name |
4-Bromo-N,N-diethylaniline |
| CAS No |
2052-06-4 |
| Synonyms |
Benzenamine, 4-bromo-N,N-diethyl-; N,N-Diethyl-p-bromoaniline; NSC 8071; p-Bromo-N,N-diethylaniline; Aniline, p-bromo-N,N-diethyl- (8CI); p-N,Nddiethylaniline |
| Molecular Formula |
C10H14BrN |
| Molecular Weight |
228.1289 |
| InChI |
InChI=1/C10H14BrN/c1-3-12(4-2)10-7-5-9(11)6-8-10/h5-8H,3-4H2,1-2H3 |
| EINECS |
218-140-8 |
| Molecular Structure |
|
| Density |
1.291g/cm3 |
| Boiling point |
270°C at 760 mmHg |
| Refractive index |
1.564 |
| Flash point |
125.1°C |
| Vapour Pressur |
0.00702mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
