ChemNet > CAS > 2058-58-4 D(-)-Asparagine
2058-58-4 D(-)-Asparagine
| product Name |
D(-)-Asparagine |
| CAS No |
2058-58-4 |
| Synonyms |
D-2-Aminosuccinamic acid; H-D-Asn-OH; D-asparagine anhydrous; D-2-Aminosuccinamic acid; D-asparagine; (2R)-2-aminobutanedioic acid |
| Molecular Formula |
C4H8N2O3 |
| Molecular Weight |
132.1191 |
| InChI |
InChI:1S/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9) |
| EINECS |
218-163-3 |
| Molecular Structure |
|
| Density |
1.404 g/cm3 |
| Melting point |
280℃ (dec.) |
| Boiling point |
361°C at 760 mmHg |
| Flash point |
172.1°C |
| Vapour Pressur |
2.38E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
