ChemNet > CAS > 2059-76-9 4-iodophenyl isothiocyanate
2059-76-9 4-iodophenyl isothiocyanate
| product Name |
4-iodophenyl isothiocyanate |
| CAS No |
2059-76-9 |
| Synonyms |
4-Iodoisothiocyanatobenzene; 1-iodo-4-isothiocyanatobenzene |
| Molecular Formula |
C7H4INS |
| Molecular Weight |
261.0828 |
| InChI |
InChI=1/C7H4INS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| Molecular Structure |
|
| Density |
1.76g/cm3 |
| Melting point |
70-76℃ |
| Boiling point |
299.5°C at 760 mmHg |
| Refractive index |
1.672 |
| Flash point |
134.9°C |
| Vapour Pressur |
0.00212mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
