ChemNet > CAS > 20595-44-2 2,3-Dichlorocinnamic acid
20595-44-2 2,3-Dichlorocinnamic acid
| product Name |
2,3-Dichlorocinnamic acid |
| CAS No |
20595-44-2 |
| Synonyms |
(2E)-3-(2,3-dichlorophenyl)prop-2-enoate; (2E)-3-(2,3-dichlorophenyl)prop-2-enoic acid |
| Molecular Formula |
C9H6Cl2O2 |
| Molecular Weight |
217.0487 |
| InChI |
InChI=1/C9H6Cl2O2/c10-7-3-1-2-6(9(7)11)4-5-8(12)13/h1-5H,(H,12,13)/b5-4+ |
| Molecular Structure |
|
| Density |
1.457g/cm3 |
| Boiling point |
363°C at 760 mmHg |
| Refractive index |
1.637 |
| Flash point |
173.3°C |
| Vapour Pressur |
6.61E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
