ChemNet > CAS > 2060-55-1 2,2'-bithiophene-5-carboxylic acid
2060-55-1 2,2'-bithiophene-5-carboxylic acid
| product Name |
2,2'-bithiophene-5-carboxylic acid |
| CAS No |
2060-55-1 |
| Synonyms |
2,2'-Bithiophene-5-carboxylic acid; 2,2'-Bithiophene-5-CA |
| Molecular Formula |
C9H6O2S2 |
| Molecular Weight |
210.2727 |
| InChI |
InChI=1/C9H6O2S2/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h1-5H,(H,10,11) |
| Molecular Structure |
|
| Density |
1.438g/cm3 |
| Melting point |
175℃ |
| Boiling point |
396.1°C at 760 mmHg |
| Refractive index |
1.668 |
| Flash point |
193.4°C |
| Vapour Pressur |
5.5E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
