ChemNet > CAS > 20651-67-6 1-(4'-Iodophenyl)butane
20651-67-6 1-(4'-Iodophenyl)butane
| product Name |
1-(4'-Iodophenyl)butane |
| CAS No |
20651-67-6 |
| Synonyms |
1-n-Butyl-4-iodobenzene; +4-n-Butyliodobenzene; 4-Iodo-n-butylbenzene; 1-butyl-4-iodobenzene |
| Molecular Formula |
C10H13I |
| Molecular Weight |
260.1147 |
| InChI |
InChI=1/C10H13I/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8H,2-4H2,1H3 |
| Molecular Structure |
|
| Density |
1.466g/cm3 |
| Boiling point |
248.4°C at 760 mmHg |
| Refractive index |
1.567 |
| Flash point |
108.9°C |
| Vapour Pressur |
0.0383mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
